C18H22O8 — CID 101455336
trimethyl (E)-1-(6-oxopyran-2-yl)hept-5-ene-1,1,6-tricarboxylate (PubChem CID 101455336) has the molecular formula C18H22O8 and a molecular weight of 366.37 g/mol. Its IUPAC name is trimethyl (E)-1-(6-oxopyran-2-yl)hept-5-ene-1,1,6-tricarboxylate.
| Compound Name | trimethyl (E)-1-(6-oxopyran-2-yl)hept-5-ene-1,1,6-tricarboxylate |
|---|---|
| PubChem CID | 101455336 |
| Molecular Formula | C18H22O8 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | trimethyl (E)-1-(6-oxopyran-2-yl)hept-5-ene-1,1,6-tricarboxylate |
| SMILES | COC(=O)/C(C)=C/CCCC(C(=O)OC)(C(=O)OC)c1cccc(=O)o1 |
| InChI | InChI=1S/C18H22O8/c1-12(15(20)23-2)8-5-6-11-18(16(21)24-3,17(22)25-4)13-9-7-10-14(19)26-13/h7-10H,5-6,11H2,1-4H3/b12-8+ |
| InChIKey | CVRMJNAVABGTLT-XYOKQWHBSA-N |
| XLogP | 1.51 |
| TPSA | 109.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|