C12H12Cl3NO — CID 101456073
2,2,2-trichloro-N-methyl-N-(2-prop-1-en-2-ylphenyl)acetamide (PubChem CID 101456073) has the molecular formula C12H12Cl3NO and a molecular weight of 292.59 g/mol. Its IUPAC name is 2,2,2-trichloro-N-methyl-N-(2-prop-1-en-2-ylphenyl)acetamide.
| Compound Name | 2,2,2-trichloro-N-methyl-N-(2-prop-1-en-2-ylphenyl)acetamide |
|---|---|
| PubChem CID | 101456073 |
| Molecular Formula | C12H12Cl3NO |
| Molecular Weight | 292.59 g/mol |
| Exact Mass | 291.00 |
| IUPAC Name | 2,2,2-trichloro-N-methyl-N-(2-prop-1-en-2-ylphenyl)acetamide |
| SMILES | C=C(C)c1ccccc1N(C)C(=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C12H12Cl3NO/c1-8(2)9-6-4-5-7-10(9)16(3)11(17)12(13,14)15/h4-7H,1H2,2-3H3 |
| InChIKey | WTAHAODYUYMQNZ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.59 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|