C27H34N2O3 — CID 101458015
tert-butyl (2R,6S)-2,4-dibenzyl-6-methyl-3-oxo-2-prop-2-enylpiperazine-1-carboxylate (PubChem CID 101458015) has the molecular formula C27H34N2O3 and a molecular weight of 434.58 g/mol. Its IUPAC name is tert-butyl (2R,6S)-2,4-dibenzyl-6-methyl-3-oxo-2-prop-2-enylpiperazine-1-carboxylate.
| Compound Name | tert-butyl (2R,6S)-2,4-dibenzyl-6-methyl-3-oxo-2-prop-2-enylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 101458015 |
| Molecular Formula | C27H34N2O3 |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.26 |
| IUPAC Name | tert-butyl (2R,6S)-2,4-dibenzyl-6-methyl-3-oxo-2-prop-2-enylpiperazine-1-carboxylate |
| SMILES | C=CC[C@@]1(Cc2ccccc2)C(=O)N(Cc2ccccc2)C[C@H](C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C27H34N2O3/c1-6-17-27(18-22-13-9-7-10-14-22)24(30)28(20-23-15-11-8-12-16-23)19-21(2)29(27)25(31)32-26(3,4)5/h6-16,21H,1,17-20H2,2-5H3/t21-,27+/m0/s1 |
| InChIKey | SYGRUQGBJIGDGR-KDYSTLNUSA-N |
| XLogP | 5.21 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|