C8H11NO4 — CID 101460562
ethyl (E)-3-(2-oxo-1,3-oxazolidin-3-yl)prop-2-enoate (PubChem CID 101460562) has the molecular formula C8H11NO4 and a molecular weight of 185.18 g/mol. Its IUPAC name is ethyl (E)-3-(2-oxo-1,3-oxazolidin-3-yl)prop-2-enoate.
| Compound Name | ethyl (E)-3-(2-oxo-1,3-oxazolidin-3-yl)prop-2-enoate |
|---|---|
| PubChem CID | 101460562 |
| Molecular Formula | C8H11NO4 |
| Molecular Weight | 185.18 g/mol |
| Exact Mass | 185.07 |
| IUPAC Name | ethyl (E)-3-(2-oxo-1,3-oxazolidin-3-yl)prop-2-enoate |
| SMILES | CCOC(=O)/C=C/N1CCOC1=O |
| InChI | InChI=1S/C8H11NO4/c1-2-12-7(10)3-4-9-5-6-13-8(9)11/h3-4H,2,5-6H2,1H3/b4-3+ |
| InChIKey | FMNTZEDUGVKXMW-ONEGZZNKSA-N |
| XLogP | 0.52 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.18 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|