C12H15NO6 — CID 102243362
ethyl 2-[(E)-3-ethoxy-3-oxoprop-1-enyl]-4-methyl-5-oxo-1,2-oxazole-3-carboxylate (PubChem CID 102243362) has the molecular formula C12H15NO6 and a molecular weight of 269.25 g/mol. Its IUPAC name is ethyl 2-[(E)-3-ethoxy-3-oxoprop-1-enyl]-4-methyl-5-oxo-1,2-oxazole-3-carboxylate.
| Compound Name | ethyl 2-[(E)-3-ethoxy-3-oxoprop-1-enyl]-4-methyl-5-oxo-1,2-oxazole-3-carboxylate |
|---|---|
| PubChem CID | 102243362 |
| Molecular Formula | C12H15NO6 |
| Molecular Weight | 269.25 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | ethyl 2-[(E)-3-ethoxy-3-oxoprop-1-enyl]-4-methyl-5-oxo-1,2-oxazole-3-carboxylate |
| SMILES | CCOC(=O)/C=C/n1oc(=O)c(C)c1C(=O)OCC |
| InChI | InChI=1S/C12H15NO6/c1-4-17-9(14)6-7-13-10(12(16)18-5-2)8(3)11(15)19-13/h6-7H,4-5H2,1-3H3/b7-6+ |
| InChIKey | TUMSJMQWJSHOAE-VOTSOKGWSA-N |
| XLogP | 0.96 |
| TPSA | 87.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.25 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|