About ethyl 3,5-dimethyl-2,6-dioxo-1,3-oxazine-4-carboxylate
ethyl 3,5-dimethyl-2,6-dioxo-1,3-oxazine-4-carboxylate (PubChem CID 565865) has the molecular formula C9H11NO5
and a molecular weight of 213.19 g/mol. Its IUPAC name is ethyl 3,5-dimethyl-2,6-dioxo-1,3-oxazine-4-carboxylate.
Analyze ethyl 3,5-dimethyl-2,6-dioxo-1,3-oxazine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3,5-dimethyl-2,6-dioxo-1,3-oxazine-4-carboxylate?
The IUPAC name of ethyl 3,5-dimethyl-2,6-dioxo-1,3-oxazine-4-carboxylate (CID 565865) is ethyl 3,5-dimethyl-2,6-dioxo-1,3-oxazine-4-carboxylate.
What is the SMILES notation for ethyl 3,5-dimethyl-2,6-dioxo-1,3-oxazine-4-carboxylate?
The canonical SMILES for ethyl 3,5-dimethyl-2,6-dioxo-1,3-oxazine-4-carboxylate is CCOC(=O)c1c(C)c(=O)oc(=O)n1C.
What is the InChIKey of ethyl 3,5-dimethyl-2,6-dioxo-1,3-oxazine-4-carboxylate?
The InChIKey is YQLWYBIDDIBTKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO5/c1-4-14-8(12)6-5(2)7(11)15-9(13)10(6)3/h4H2,1-3H3.
What are the key properties of ethyl 3,5-dimethyl-2,6-dioxo-1,3-oxazine-4-carboxylate?
ethyl 3,5-dimethyl-2,6-dioxo-1,3-oxazine-4-carboxylate has a molecular weight of 213.19 g/mol, XLogP of -0.18, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3,5-dimethyl-2,6-dioxo-1,3-oxazine-4-carboxylate is sourced from PubChem (CID 565865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).