About [5-(naphthalen-1-yldiazenyl)quinolin-8-yl] (3S)-3-phenylbutanoate
[5-(naphthalen-1-yldiazenyl)quinolin-8-yl] (3S)-3-phenylbutanoate (PubChem CID 101461426) has the molecular formula C29H23N3O2
and a molecular weight of 445.52 g/mol. Its IUPAC name is [5-(naphthalen-1-yldiazenyl)quinolin-8-yl] (3S)-3-phenylbutanoate.
Molecular Properties
| Compound Name | [5-(naphthalen-1-yldiazenyl)quinolin-8-yl] (3S)-3-phenylbutanoate |
| PubChem CID | 101461426 |
| Molecular Formula | C29H23N3O2 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | [5-(naphthalen-1-yldiazenyl)quinolin-8-yl] (3S)-3-phenylbutanoate |
| SMILES | C[C@@H](CC(=O)Oc1ccc(/N=N/c2cccc3ccccc23)c2cccnc12)c1ccccc1 |
| InChI | InChI=1S/C29H23N3O2/c1-20(21-9-3-2-4-10-21)19-28(33)34-27-17-16-26(24-14-8-18-30-29(24)27)32-31-25-15-7-12-22-11-5-6-13-23(22)25/h2-18,20H,19H2,1H3/b32-31+/t20-/m0/s1 |
| InChIKey | ZVPXJKHNRAZAPD-IGXVRLBYSA-N |
| XLogP | 7.90 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [5-(naphthalen-1-yldiazenyl)quinolin-8-yl] (3S)-3-phenylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(naphthalen-1-yldiazenyl)quinolin-8-yl] (3S)-3-phenylbutanoate?
The IUPAC name of [5-(naphthalen-1-yldiazenyl)quinolin-8-yl] (3S)-3-phenylbutanoate (CID 101461426) is [5-(naphthalen-1-yldiazenyl)quinolin-8-yl] (3S)-3-phenylbutanoate.
What is the SMILES notation for [5-(naphthalen-1-yldiazenyl)quinolin-8-yl] (3S)-3-phenylbutanoate?
The canonical SMILES for [5-(naphthalen-1-yldiazenyl)quinolin-8-yl] (3S)-3-phenylbutanoate is C[C@@H](CC(=O)Oc1ccc(/N=N/c2cccc3ccccc23)c2cccnc12)c1ccccc1.
What is the InChIKey of [5-(naphthalen-1-yldiazenyl)quinolin-8-yl] (3S)-3-phenylbutanoate?
The InChIKey is ZVPXJKHNRAZAPD-IGXVRLBYSA-N. The full InChI is InChI=1S/C29H23N3O2/c1-20(21-9-3-2-4-10-21)19-28(33)34-27-17-16-26(24-14-8-18-30-29(24)27)32-31-25-15-7-12-22-11-5-6-13-23(22)25/h2-18,20H,19H2,1H3/b32-31+/t20-/m0/s1.
What are the key properties of [5-(naphthalen-1-yldiazenyl)quinolin-8-yl] (3S)-3-phenylbutanoate?
[5-(naphthalen-1-yldiazenyl)quinolin-8-yl] (3S)-3-phenylbutanoate has a molecular weight of 445.52 g/mol, XLogP of 7.90, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(naphthalen-1-yldiazenyl)quinolin-8-yl] (3S)-3-phenylbutanoate is sourced from PubChem (CID 101461426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).