C20H16BrNO2 — CID 60581224
(2-bromo-3-pyridinyl) 3,3-diphenylpropanoate (PubChem CID 60581224) has the molecular formula C20H16BrNO2 and a molecular weight of 382.26 g/mol. Its IUPAC name is (2-bromo-3-pyridinyl) 3,3-diphenylpropanoate.
| Compound Name | (2-bromo-3-pyridinyl) 3,3-diphenylpropanoate |
|---|---|
| PubChem CID | 60581224 |
| Molecular Formula | C20H16BrNO2 |
| Molecular Weight | 382.26 g/mol |
| Exact Mass | 381.04 |
| IUPAC Name | (2-bromo-3-pyridinyl) 3,3-diphenylpropanoate |
| SMILES | O=C(CC(c1ccccc1)c1ccccc1)Oc1cccnc1Br |
| InChI | InChI=1S/C20H16BrNO2/c21-20-18(12-7-13-22-20)24-19(23)14-17(15-8-3-1-4-9-15)16-10-5-2-6-11-16/h1-13,17H,14H2 |
| InChIKey | JDQALMSIMUIYBM-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.26 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|