C18H14BrN3O3 — CID 60581897
(2-bromo-3-pyridinyl) 2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-oxoacetate (PubChem CID 60581897) has the molecular formula C18H14BrN3O3 and a molecular weight of 400.23 g/mol. Its IUPAC name is (2-bromo-3-pyridinyl) 2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-oxoacetate.
| Compound Name | (2-bromo-3-pyridinyl) 2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-oxoacetate |
|---|---|
| PubChem CID | 60581897 |
| Molecular Formula | C18H14BrN3O3 |
| Molecular Weight | 400.23 g/mol |
| Exact Mass | 399.02 |
| IUPAC Name | (2-bromo-3-pyridinyl) 2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-oxoacetate |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1C(=O)C(=O)Oc1cccnc1Br |
| InChI | InChI=1S/C18H14BrN3O3/c1-11-15(12(2)22(21-11)13-7-4-3-5-8-13)16(23)18(24)25-14-9-6-10-20-17(14)19/h3-10H,1-2H3 |
| InChIKey | XCODGFJWCZJZDK-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.23 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|