C18H30N4O11 — CID 101466213
ethyl 2,2-bis[ethoxycarbonyl-(ethoxycarbonylamino)amino]-3-oxobutanoate (PubChem CID 101466213) has the molecular formula C18H30N4O11 and a molecular weight of 478.46 g/mol. Its IUPAC name is ethyl 2,2-bis[ethoxycarbonyl-(ethoxycarbonylamino)amino]-3-oxobutanoate.
| Compound Name | ethyl 2,2-bis[ethoxycarbonyl-(ethoxycarbonylamino)amino]-3-oxobutanoate |
|---|---|
| PubChem CID | 101466213 |
| Molecular Formula | C18H30N4O11 |
| Molecular Weight | 478.46 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | ethyl 2,2-bis[ethoxycarbonyl-(ethoxycarbonylamino)amino]-3-oxobutanoate |
| SMILES | CCOC(=O)NN(C(=O)OCC)C(C(C)=O)(C(=O)OCC)N(NC(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C18H30N4O11/c1-7-29-13(24)18(12(6)23,21(16(27)32-10-4)19-14(25)30-8-2)22(17(28)33-11-5)20-15(26)31-9-3/h7-11H2,1-6H3,(H,19,25)(H,20,26) |
| InChIKey | UGGFUYFAZBXHPD-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 179.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.46 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|