C19H28N2O11 — CID 101124437
[(3aR,6R,6aR)-2,2-dimethyl-4-oxo-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl]methyl (2S)-2-[ethoxycarbonyl-(ethoxycarbonylamino)amino]-2-methyl-3-oxobutanoate (PubChem CID 101124437) has the molecular formula C19H28N2O11 and a molecular weight of 460.44 g/mol. Its IUPAC name is [(3aR,6R,6aR)-2,2-dimethyl-4-oxo-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl]methyl (2S)-2-[ethoxycarbonyl-(ethoxycarbonylamino)amino]-2-methyl-3-oxobutanoate.
| Compound Name | [(3aR,6R,6aR)-2,2-dimethyl-4-oxo-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl]methyl (2S)-2-[ethoxycarbonyl-(ethoxycarbonylamino)amino]-2-methyl-3-oxobutanoate |
|---|---|
| PubChem CID | 101124437 |
| Molecular Formula | C19H28N2O11 |
| Molecular Weight | 460.44 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | [(3aR,6R,6aR)-2,2-dimethyl-4-oxo-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl]methyl (2S)-2-[ethoxycarbonyl-(ethoxycarbonylamino)amino]-2-methyl-3-oxobutanoate |
| SMILES | CCOC(=O)NN(C(=O)OCC)[C@@](C)(C(C)=O)C(=O)OC[C@H]1OC(=O)[C@@H]2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C19H28N2O11/c1-7-27-16(25)20-21(17(26)28-8-2)19(6,10(3)22)15(24)29-9-11-12-13(14(23)30-11)32-18(4,5)31-12/h11-13H,7-9H2,1-6H3,(H,20,25)/t11-,12-,13-,19+/m1/s1 |
| InChIKey | VLCRBDNDYVVCNO-FAKXAQORSA-N |
| XLogP | 0.44 |
| TPSA | 156.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.44 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|