C17H24O8 — CID 101124441
[(3aR,6R,6aR)-2,2-dimethyl-4-oxo-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl]methyl (2S)-2-acetyl-2-methyl-5-oxohexanoate (PubChem CID 101124441) has the molecular formula C17H24O8 and a molecular weight of 356.37 g/mol. Its IUPAC name is [(3aR,6R,6aR)-2,2-dimethyl-4-oxo-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl]methyl (2S)-2-acetyl-2-methyl-5-oxohexanoate.
| Compound Name | [(3aR,6R,6aR)-2,2-dimethyl-4-oxo-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl]methyl (2S)-2-acetyl-2-methyl-5-oxohexanoate |
|---|---|
| PubChem CID | 101124441 |
| Molecular Formula | C17H24O8 |
| Molecular Weight | 356.37 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | [(3aR,6R,6aR)-2,2-dimethyl-4-oxo-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl]methyl (2S)-2-acetyl-2-methyl-5-oxohexanoate |
| SMILES | CC(=O)CC[C@@](C)(C(C)=O)C(=O)OC[C@H]1OC(=O)[C@@H]2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C17H24O8/c1-9(18)6-7-17(5,10(2)19)15(21)22-8-11-12-13(14(20)23-11)25-16(3,4)24-12/h11-13H,6-8H2,1-5H3/t11-,12-,13-,17+/m1/s1 |
| InChIKey | MIZIOCNFQFYDJU-ZFRZLUBXSA-N |
| XLogP | 0.94 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.37 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|