C14H13NO4 — CID 101467916
2-(5,7-dimethoxy-3,4-dioxo-1,2-dihydronaphthalen-2-yl)acetonitrile (PubChem CID 101467916) has the molecular formula C14H13NO4 and a molecular weight of 259.26 g/mol. Its IUPAC name is 2-(5,7-dimethoxy-3,4-dioxo-1,2-dihydronaphthalen-2-yl)acetonitrile.
| Compound Name | 2-(5,7-dimethoxy-3,4-dioxo-1,2-dihydronaphthalen-2-yl)acetonitrile |
|---|---|
| PubChem CID | 101467916 |
| Molecular Formula | C14H13NO4 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | 2-(5,7-dimethoxy-3,4-dioxo-1,2-dihydronaphthalen-2-yl)acetonitrile |
| SMILES | COc1cc2c(c(OC)c1)C(=O)C(=O)C(CC#N)C2 |
| InChI | InChI=1S/C14H13NO4/c1-18-10-6-9-5-8(3-4-15)13(16)14(17)12(9)11(7-10)19-2/h6-8H,3,5H2,1-2H3 |
| InChIKey | FEXHUDASENKDRV-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|