About 2-phenylethyl (2R)-2-naphthalen-2-ylpent-4-enoate
2-phenylethyl (2R)-2-naphthalen-2-ylpent-4-enoate (PubChem CID 101472479) has the molecular formula C23H22O2
and a molecular weight of 330.43 g/mol. Its IUPAC name is 2-phenylethyl (2R)-2-naphthalen-2-ylpent-4-enoate.
Molecular Properties
| Compound Name | 2-phenylethyl (2R)-2-naphthalen-2-ylpent-4-enoate |
| PubChem CID | 101472479 |
| Molecular Formula | C23H22O2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 2-phenylethyl (2R)-2-naphthalen-2-ylpent-4-enoate |
| SMILES | C=CC[C@@H](C(=O)OCCc1ccccc1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C23H22O2/c1-2-8-22(21-14-13-19-11-6-7-12-20(19)17-21)23(24)25-16-15-18-9-4-3-5-10-18/h2-7,9-14,17,22H,1,8,15-16H2/t22-/m1/s1 |
| InChIKey | PSPMUWDEVLGTDJ-JOCHJYFZSA-N |
| XLogP | 5.29 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-phenylethyl (2R)-2-naphthalen-2-ylpent-4-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylethyl (2R)-2-naphthalen-2-ylpent-4-enoate?
The IUPAC name of 2-phenylethyl (2R)-2-naphthalen-2-ylpent-4-enoate (CID 101472479) is 2-phenylethyl (2R)-2-naphthalen-2-ylpent-4-enoate.
What is the SMILES notation for 2-phenylethyl (2R)-2-naphthalen-2-ylpent-4-enoate?
The canonical SMILES for 2-phenylethyl (2R)-2-naphthalen-2-ylpent-4-enoate is C=CC[C@@H](C(=O)OCCc1ccccc1)c1ccc2ccccc2c1.
What is the InChIKey of 2-phenylethyl (2R)-2-naphthalen-2-ylpent-4-enoate?
The InChIKey is PSPMUWDEVLGTDJ-JOCHJYFZSA-N. The full InChI is InChI=1S/C23H22O2/c1-2-8-22(21-14-13-19-11-6-7-12-20(19)17-21)23(24)25-16-15-18-9-4-3-5-10-18/h2-7,9-14,17,22H,1,8,15-16H2/t22-/m1/s1.
What are the key properties of 2-phenylethyl (2R)-2-naphthalen-2-ylpent-4-enoate?
2-phenylethyl (2R)-2-naphthalen-2-ylpent-4-enoate has a molecular weight of 330.43 g/mol, XLogP of 5.29, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylethyl (2R)-2-naphthalen-2-ylpent-4-enoate is sourced from PubChem (CID 101472479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).