C23H30N2O4S — CID 101472499
tert-butyl N-[(1R,4Z,8S)-8-[(4R)-4-phenyl-2-sulfanylidene-1,3-oxazolidine-3-carbonyl]cyclooct-4-en-1-yl]carbamate (PubChem CID 101472499) has the molecular formula C23H30N2O4S and a molecular weight of 430.57 g/mol. Its IUPAC name is tert-butyl N-[(1R,4Z,8S)-8-[(4R)-4-phenyl-2-sulfanylidene-1,3-oxazolidine-3-carbonyl]cyclooct-4-en-1-yl]carbamate.
| Compound Name | tert-butyl N-[(1R,4Z,8S)-8-[(4R)-4-phenyl-2-sulfanylidene-1,3-oxazolidine-3-carbonyl]cyclooct-4-en-1-yl]carbamate |
|---|---|
| PubChem CID | 101472499 |
| Molecular Formula | C23H30N2O4S |
| Molecular Weight | 430.57 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | tert-butyl N-[(1R,4Z,8S)-8-[(4R)-4-phenyl-2-sulfanylidene-1,3-oxazolidine-3-carbonyl]cyclooct-4-en-1-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CC/C=C\CC[C@@H]1C(=O)N1C(=S)OC[C@H]1c1ccccc1 |
| InChI | InChI=1S/C23H30N2O4S/c1-23(2,3)29-21(27)24-18-14-10-5-4-9-13-17(18)20(26)25-19(15-28-22(25)30)16-11-7-6-8-12-16/h4-8,11-12,17-19H,9-10,13-15H2,1-3H3,(H,24,27)/b5-4-/t17-,18+,19-/m0/s1 |
| InChIKey | NQEPOUSIRYEJEJ-BSMJBHPZSA-N |
| XLogP | 4.51 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.57 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|