C25H34O4 — CID 101473446
(3R)-8-hydroxy-4,4-dimethyl-7-(3-methylbut-2-enyl)-9-(2-methylpropanoyl)-3-prop-1-en-2-yltricyclo[5.3.1.01,5]undec-8-ene-10,11-dione (PubChem CID 101473446) has the molecular formula C25H34O4 and a molecular weight of 398.54 g/mol. Its IUPAC name is (3R)-8-hydroxy-4,4-dimethyl-7-(3-methylbut-2-enyl)-9-(2-methylpropanoyl)-3-prop-1-en-2-yltricyclo[5.3.1.01,5]undec-8-ene-10,11-dione.
| Compound Name | (3R)-8-hydroxy-4,4-dimethyl-7-(3-methylbut-2-enyl)-9-(2-methylpropanoyl)-3-prop-1-en-2-yltricyclo[5.3.1.01,5]undec-8-ene-10,11-dione |
|---|---|
| PubChem CID | 101473446 |
| Molecular Formula | C25H34O4 |
| Molecular Weight | 398.54 g/mol |
| Exact Mass | 398.25 |
| IUPAC Name | (3R)-8-hydroxy-4,4-dimethyl-7-(3-methylbut-2-enyl)-9-(2-methylpropanoyl)-3-prop-1-en-2-yltricyclo[5.3.1.01,5]undec-8-ene-10,11-dione |
| SMILES | C=C(C)[C@H]1CC23C(=O)C(C(=O)C(C)C)=C(O)C(CC=C(C)C)(CC2C1(C)C)C3=O |
| InChI | InChI=1S/C25H34O4/c1-13(2)9-10-24-12-17-23(7,8)16(14(3)4)11-25(17,22(24)29)21(28)18(20(24)27)19(26)15(5)6/h9,15-17,27H,3,10-12H2,1-2,4-8H3/t16-,17?,24?,25?/m1/s1 |
| InChIKey | YVGVREFENMXHLV-ZQFXJAFESA-N |
| XLogP | 5.15 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.54 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|