C25H34O5 — CID 74340851
3-acetyl-4,4,7-trimethyl-9-(3-methylbut-2-enyl)-9-(2-methylpropanoyl)tricyclo[5.3.1.01,5]undecane-8,10,11-trione (PubChem CID 74340851) has the molecular formula C25H34O5 and a molecular weight of 414.54 g/mol. Its IUPAC name is 3-acetyl-4,4,7-trimethyl-9-(3-methylbut-2-enyl)-9-(2-methylpropanoyl)tricyclo[5.3.1.01,5]undecane-8,10,11-trione.
| Compound Name | 3-acetyl-4,4,7-trimethyl-9-(3-methylbut-2-enyl)-9-(2-methylpropanoyl)tricyclo[5.3.1.01,5]undecane-8,10,11-trione |
|---|---|
| PubChem CID | 74340851 |
| Molecular Formula | C25H34O5 |
| Molecular Weight | 414.54 g/mol |
| Exact Mass | 414.24 |
| IUPAC Name | 3-acetyl-4,4,7-trimethyl-9-(3-methylbut-2-enyl)-9-(2-methylpropanoyl)tricyclo[5.3.1.01,5]undecane-8,10,11-trione |
| SMILES | CC(=O)C1CC23C(=O)C(C)(CC2C1(C)C)C(=O)C(CC=C(C)C)(C(=O)C(C)C)C3=O |
| InChI | InChI=1S/C25H34O5/c1-13(2)9-10-24(18(27)14(3)4)19(28)23(8)12-17-22(6,7)16(15(5)26)11-25(17,20(23)29)21(24)30/h9,14,16-17H,10-12H2,1-8H3 |
| InChIKey | YWCYHQDJGKSIEV-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 85.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.54 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|