C22H26NO4S+ — CID 101476444
[2,6-dimethoxy-4-[2-(3-methyl-1,3-benzothiazol-3-ium-2-yl)ethyl]phenyl] butanoate (PubChem CID 101476444) has the molecular formula C22H26NO4S+ and a molecular weight of 400.52 g/mol. Its IUPAC name is [2,6-dimethoxy-4-[2-(3-methyl-1,3-benzothiazol-3-ium-2-yl)ethyl]phenyl] butanoate.
| Compound Name | [2,6-dimethoxy-4-[2-(3-methyl-1,3-benzothiazol-3-ium-2-yl)ethyl]phenyl] butanoate |
|---|---|
| PubChem CID | 101476444 |
| Molecular Formula | C22H26NO4S+ |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | [2,6-dimethoxy-4-[2-(3-methyl-1,3-benzothiazol-3-ium-2-yl)ethyl]phenyl] butanoate |
| SMILES | CCCC(=O)Oc1c(OC)cc(CCc2sc3ccccc3[n+]2C)cc1OC |
| InChI | InChI=1S/C22H26NO4S/c1-5-8-21(24)27-22-17(25-3)13-15(14-18(22)26-4)11-12-20-23(2)16-9-6-7-10-19(16)28-20/h6-7,9-10,13-14H,5,8,11-12H2,1-4H3/q+1 |
| InChIKey | PWFFKGYSGLSJOL-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 48.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|