C19H18N4O7 — CID 101478371
benzyl N-[(2S)-1-(4,7-dinitro-2,3-dihydroindol-1-yl)-1-oxopropan-2-yl]carbamate (PubChem CID 101478371) has the molecular formula C19H18N4O7 and a molecular weight of 414.37 g/mol. Its IUPAC name is benzyl N-[(2S)-1-(4,7-dinitro-2,3-dihydroindol-1-yl)-1-oxopropan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-(4,7-dinitro-2,3-dihydroindol-1-yl)-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 101478371 |
| Molecular Formula | C19H18N4O7 |
| Molecular Weight | 414.37 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | benzyl N-[(2S)-1-(4,7-dinitro-2,3-dihydroindol-1-yl)-1-oxopropan-2-yl]carbamate |
| SMILES | C[C@H](NC(=O)OCc1ccccc1)C(=O)N1CCc2c([N+](=O)[O-])ccc([N+](=O)[O-])c21 |
| InChI | InChI=1S/C19H18N4O7/c1-12(20-19(25)30-11-13-5-3-2-4-6-13)18(24)21-10-9-14-15(22(26)27)7-8-16(17(14)21)23(28)29/h2-8,12H,9-11H2,1H3,(H,20,25)/t12-/m0/s1 |
| InChIKey | IDQFSBZDWWGORC-LBPRGKRZSA-N |
| XLogP | 2.71 |
| TPSA | 144.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.37 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|