C52H40N6 — CID 101478386
4,6-dimethyl-1-N,1-N,3-N,3-N-tetrakis(4-pyridin-4-ylphenyl)benzene-1,3-diamine (PubChem CID 101478386) has the molecular formula C52H40N6 and a molecular weight of 748.93 g/mol. Its IUPAC name is 4,6-dimethyl-1-N,1-N,3-N,3-N-tetrakis(4-pyridin-4-ylphenyl)benzene-1,3-diamine.
| Compound Name | 4,6-dimethyl-1-N,1-N,3-N,3-N-tetrakis(4-pyridin-4-ylphenyl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 101478386 |
| Molecular Formula | C52H40N6 |
| Molecular Weight | 748.93 g/mol |
| Exact Mass | 748.33 |
| IUPAC Name | 4,6-dimethyl-1-N,1-N,3-N,3-N-tetrakis(4-pyridin-4-ylphenyl)benzene-1,3-diamine |
| SMILES | Cc1cc(C)c(N(c2ccc(-c3ccncc3)cc2)c2ccc(-c3ccncc3)cc2)cc1N(c1ccc(-c2ccncc2)cc1)c1ccc(-c2ccncc2)cc1 |
| InChI | InChI=1S/C52H40N6/c1-37-35-38(2)52(58(49-15-7-41(8-16-49)45-23-31-55-32-24-45)50-17-9-42(10-18-50)46-25-33-56-34-26-46)36-51(37)57(47-11-3-39(4-12-47)43-19-27-53-28-20-43)48-13-5-40(6-14-48)44-21-29-54-30-22-44/h3-36H,1-2H3 |
| InChIKey | GFDYUTDXVUQAJM-UHFFFAOYSA-N |
| XLogP | 13.49 |
| TPSA | 58.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.93 |
| LogP ≤ 5 | 13.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |