About 2-(furan-2-yl)pyrido[3,2-d]pyrimidine
2-(furan-2-yl)pyrido[3,2-d]pyrimidine (PubChem CID 101478815) has the molecular formula C11H7N3O
and a molecular weight of 197.20 g/mol. Its IUPAC name is 2-(furan-2-yl)pyrido[3,2-d]pyrimidine.
Molecular Properties
| Compound Name | 2-(furan-2-yl)pyrido[3,2-d]pyrimidine |
| PubChem CID | 101478815 |
| Molecular Formula | C11H7N3O |
| Molecular Weight | 197.20 g/mol |
| Exact Mass | 197.06 |
| IUPAC Name | 2-(furan-2-yl)pyrido[3,2-d]pyrimidine |
| SMILES | c1coc(-c2ncc3ncccc3n2)c1 |
| InChI | InChI=1S/C11H7N3O/c1-3-8-9(12-5-1)7-13-11(14-8)10-4-2-6-15-10/h1-7H |
| InChIKey | MXCAPTUBSXMBNB-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.20 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(furan-2-yl)pyrido[3,2-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(furan-2-yl)pyrido[3,2-d]pyrimidine?
The IUPAC name of 2-(furan-2-yl)pyrido[3,2-d]pyrimidine (CID 101478815) is 2-(furan-2-yl)pyrido[3,2-d]pyrimidine.
What is the SMILES notation for 2-(furan-2-yl)pyrido[3,2-d]pyrimidine?
The canonical SMILES for 2-(furan-2-yl)pyrido[3,2-d]pyrimidine is c1coc(-c2ncc3ncccc3n2)c1.
What is the InChIKey of 2-(furan-2-yl)pyrido[3,2-d]pyrimidine?
The InChIKey is MXCAPTUBSXMBNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7N3O/c1-3-8-9(12-5-1)7-13-11(14-8)10-4-2-6-15-10/h1-7H.
What are the key properties of 2-(furan-2-yl)pyrido[3,2-d]pyrimidine?
2-(furan-2-yl)pyrido[3,2-d]pyrimidine has a molecular weight of 197.20 g/mol, XLogP of 2.28, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(furan-2-yl)pyrido[3,2-d]pyrimidine is sourced from PubChem (CID 101478815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).