C15H24N4S — CID 101480128
1-phenyl-3-[3-[[(2S)-pyrrolidin-2-yl]methylamino]propyl]thiourea (PubChem CID 101480128) has the molecular formula C15H24N4S and a molecular weight of 292.45 g/mol. Its IUPAC name is 1-phenyl-3-[3-[[(2S)-pyrrolidin-2-yl]methylamino]propyl]thiourea.
| Compound Name | 1-phenyl-3-[3-[[(2S)-pyrrolidin-2-yl]methylamino]propyl]thiourea |
|---|---|
| PubChem CID | 101480128 |
| Molecular Formula | C15H24N4S |
| Molecular Weight | 292.45 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | 1-phenyl-3-[3-[[(2S)-pyrrolidin-2-yl]methylamino]propyl]thiourea |
| SMILES | S=C(NCCCNC[C@@H]1CCCN1)Nc1ccccc1 |
| InChI | InChI=1S/C15H24N4S/c20-15(19-13-6-2-1-3-7-13)18-11-5-9-16-12-14-8-4-10-17-14/h1-3,6-7,14,16-17H,4-5,8-12H2,(H2,18,19,20)/t14-/m0/s1 |
| InChIKey | HSZQBDZTMUEEQU-AWEZNQCLSA-N |
| XLogP | 1.70 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.45 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|