C32H47NO5Si — CID 101480548
tert-butyl (4S)-4-[(Z,1S)-5-[tert-butyl(diphenyl)silyl]oxy-1-hydroxy-2-methylpent-2-enyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 101480548) has the molecular formula C32H47NO5Si and a molecular weight of 553.82 g/mol. Its IUPAC name is tert-butyl (4S)-4-[(Z,1S)-5-[tert-butyl(diphenyl)silyl]oxy-1-hydroxy-2-methylpent-2-enyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4S)-4-[(Z,1S)-5-[tert-butyl(diphenyl)silyl]oxy-1-hydroxy-2-methylpent-2-enyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 101480548 |
| Molecular Formula | C32H47NO5Si |
| Molecular Weight | 553.82 g/mol |
| Exact Mass | 553.32 |
| IUPAC Name | tert-butyl (4S)-4-[(Z,1S)-5-[tert-butyl(diphenyl)silyl]oxy-1-hydroxy-2-methylpent-2-enyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | C/C(=C/CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@H](O)[C@@H]1COC(C)(C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C32H47NO5Si/c1-24(28(34)27-23-36-32(8,9)33(27)29(35)38-30(2,3)4)17-16-22-37-39(31(5,6)7,25-18-12-10-13-19-25)26-20-14-11-15-21-26/h10-15,17-21,27-28,34H,16,22-23H2,1-9H3/b24-17-/t27-,28-/m0/s1 |
| InChIKey | DFDVRIJKKQYTGD-YROODXBUSA-N |
| XLogP | 5.63 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.82 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|