C25H47BOSi — CID 101480785
trimethyl-[9-[(4S,5R)-5-propa-1,2-dienyldecan-4-yl]oxy-9-borabicyclo[3.3.2]decan-10-yl]silane (PubChem CID 101480785) has the molecular formula C25H47BOSi and a molecular weight of 402.55 g/mol. Its IUPAC name is trimethyl-[9-[(4S,5R)-5-propa-1,2-dienyldecan-4-yl]oxy-9-borabicyclo[3.3.2]decan-10-yl]silane.
| Compound Name | trimethyl-[9-[(4S,5R)-5-propa-1,2-dienyldecan-4-yl]oxy-9-borabicyclo[3.3.2]decan-10-yl]silane |
|---|---|
| PubChem CID | 101480785 |
| Molecular Formula | C25H47BOSi |
| Molecular Weight | 402.55 g/mol |
| Exact Mass | 402.35 |
| IUPAC Name | trimethyl-[9-[(4S,5R)-5-propa-1,2-dienyldecan-4-yl]oxy-9-borabicyclo[3.3.2]decan-10-yl]silane |
| SMILES | C=C=C[C@@H](CCCCC)[C@H](CCC)OB1C2CCCC(CCC2)C1[Si](C)(C)C |
| InChI | InChI=1S/C25H47BOSi/c1-7-10-11-16-21(14-8-2)24(15-9-3)27-26-23-19-12-17-22(18-13-20-23)25(26)28(4,5)6/h14,21-25H,2,7,9-13,15-20H2,1,3-6H3/t21-,22?,23?,24-,25?/m0/s1 |
| InChIKey | FSYZVMNCSRWNBZ-BPLIUSEHSA-N |
| XLogP | 8.30 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.55 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|