C21H39BSi — CID 101480783
trimethyl-[9-[(3E)-nona-1,3-dien-2-yl]-9-borabicyclo[3.3.2]decan-10-yl]silane (PubChem CID 101480783) has the molecular formula C21H39BSi and a molecular weight of 330.44 g/mol. Its IUPAC name is trimethyl-[9-[(3E)-nona-1,3-dien-2-yl]-9-borabicyclo[3.3.2]decan-10-yl]silane.
| Compound Name | trimethyl-[9-[(3E)-nona-1,3-dien-2-yl]-9-borabicyclo[3.3.2]decan-10-yl]silane |
|---|---|
| PubChem CID | 101480783 |
| Molecular Formula | C21H39BSi |
| Molecular Weight | 330.44 g/mol |
| Exact Mass | 330.29 |
| IUPAC Name | trimethyl-[9-[(3E)-nona-1,3-dien-2-yl]-9-borabicyclo[3.3.2]decan-10-yl]silane |
| SMILES | C=C(/C=C/CCCCC)B1C2CCCC(CCC2)C1[Si](C)(C)C |
| InChI | InChI=1S/C21H39BSi/c1-6-7-8-9-10-13-18(2)22-20-16-11-14-19(15-12-17-20)21(22)23(3,4)5/h10,13,19-21H,2,6-9,11-12,14-17H2,1,3-5H3/b13-10+ |
| InChIKey | WQOLSGDIFAWMTI-JLHYYAGUSA-N |
| XLogP | 7.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.44 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|