C18H24O3 — CID 101488096
3-acetyl-4-phenyldecane-2,6-dione (PubChem CID 101488096) has the molecular formula C18H24O3 and a molecular weight of 288.39 g/mol. Its IUPAC name is 3-acetyl-4-phenyldecane-2,6-dione.
| Compound Name | 3-acetyl-4-phenyldecane-2,6-dione |
|---|---|
| PubChem CID | 101488096 |
| Molecular Formula | C18H24O3 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | 3-acetyl-4-phenyldecane-2,6-dione |
| SMILES | CCCCC(=O)CC(c1ccccc1)C(C(C)=O)C(C)=O |
| InChI | InChI=1S/C18H24O3/c1-4-5-11-16(21)12-17(15-9-7-6-8-10-15)18(13(2)19)14(3)20/h6-10,17-18H,4-5,11-12H2,1-3H3 |
| InChIKey | AVCRTPKEPVVNLN-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|