C22H46O5Si2 — CID 101488292
methyl (3R,4R,5S,6R)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-3-hydroxy-4-methyl-2-methylideneheptanoate (PubChem CID 101488292) has the molecular formula C22H46O5Si2 and a molecular weight of 446.78 g/mol. Its IUPAC name is methyl (3R,4R,5S,6R)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-3-hydroxy-4-methyl-2-methylideneheptanoate.
| Compound Name | methyl (3R,4R,5S,6R)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-3-hydroxy-4-methyl-2-methylideneheptanoate |
|---|---|
| PubChem CID | 101488292 |
| Molecular Formula | C22H46O5Si2 |
| Molecular Weight | 446.78 g/mol |
| Exact Mass | 446.29 |
| IUPAC Name | methyl (3R,4R,5S,6R)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-3-hydroxy-4-methyl-2-methylideneheptanoate |
| SMILES | C=C(C(=O)OC)[C@H](O)[C@@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H46O5Si2/c1-15(18(23)16(2)20(24)25-10)19(27-29(13,14)22(7,8)9)17(3)26-28(11,12)21(4,5)6/h15,17-19,23H,2H2,1,3-14H3/t15-,17-,18-,19+/m1/s1 |
| InChIKey | XTBMRDAMFQONMY-OWYHZJEWSA-N |
| XLogP | 5.51 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.78 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|