C20H40O4Si — CID 102092857
methyl (3R,6S)-3-hydroxy-6-methyl-2-methylidene-8-tri(propan-2-yl)silyloxyoctanoate (PubChem CID 102092857) has the molecular formula C20H40O4Si and a molecular weight of 372.62 g/mol. Its IUPAC name is methyl (3R,6S)-3-hydroxy-6-methyl-2-methylidene-8-tri(propan-2-yl)silyloxyoctanoate.
| Compound Name | methyl (3R,6S)-3-hydroxy-6-methyl-2-methylidene-8-tri(propan-2-yl)silyloxyoctanoate |
|---|---|
| PubChem CID | 102092857 |
| Molecular Formula | C20H40O4Si |
| Molecular Weight | 372.62 g/mol |
| Exact Mass | 372.27 |
| IUPAC Name | methyl (3R,6S)-3-hydroxy-6-methyl-2-methylidene-8-tri(propan-2-yl)silyloxyoctanoate |
| SMILES | C=C(C(=O)OC)[C@H](O)CC[C@H](C)CCO[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C20H40O4Si/c1-14(2)25(15(3)4,16(5)6)24-13-12-17(7)10-11-19(21)18(8)20(22)23-9/h14-17,19,21H,8,10-13H2,1-7,9H3/t17-,19+/m0/s1 |
| InChIKey | WBZGEXCHOZPTBJ-PKOBYXMFSA-N |
| XLogP | 5.07 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.62 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|