C20H40O4Si — CID 15254806
ethyl 6-hydroxy-2-methylidene-8-tri(propan-2-yl)silyloxyoctanoate (PubChem CID 15254806) has the molecular formula C20H40O4Si and a molecular weight of 372.62 g/mol. Its IUPAC name is ethyl 6-hydroxy-2-methylidene-8-tri(propan-2-yl)silyloxyoctanoate.
| Compound Name | ethyl 6-hydroxy-2-methylidene-8-tri(propan-2-yl)silyloxyoctanoate |
|---|---|
| PubChem CID | 15254806 |
| Molecular Formula | C20H40O4Si |
| Molecular Weight | 372.62 g/mol |
| Exact Mass | 372.27 |
| IUPAC Name | ethyl 6-hydroxy-2-methylidene-8-tri(propan-2-yl)silyloxyoctanoate |
| SMILES | C=C(CCCC(O)CCO[Si](C(C)C)(C(C)C)C(C)C)C(=O)OCC |
| InChI | InChI=1S/C20H40O4Si/c1-9-23-20(22)18(8)11-10-12-19(21)13-14-24-25(15(2)3,16(4)5)17(6)7/h15-17,19,21H,8-14H2,1-7H3 |
| InChIKey | ULNYKCPGWMYFBW-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.62 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|