C16H30O4Si — CID 134902088
methyl 2-[(2S,5R)-5-[(2R)-2-[tert-butyl(dimethyl)silyl]-2-hydroxyethyl]oxolan-2-yl]prop-2-enoate (PubChem CID 134902088) has the molecular formula C16H30O4Si and a molecular weight of 314.50 g/mol. Its IUPAC name is methyl 2-[(2S,5R)-5-[(2R)-2-[tert-butyl(dimethyl)silyl]-2-hydroxyethyl]oxolan-2-yl]prop-2-enoate.
| Compound Name | methyl 2-[(2S,5R)-5-[(2R)-2-[tert-butyl(dimethyl)silyl]-2-hydroxyethyl]oxolan-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 134902088 |
| Molecular Formula | C16H30O4Si |
| Molecular Weight | 314.50 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | methyl 2-[(2S,5R)-5-[(2R)-2-[tert-butyl(dimethyl)silyl]-2-hydroxyethyl]oxolan-2-yl]prop-2-enoate |
| SMILES | C=C(C(=O)OC)[C@@H]1CC[C@H](C[C@H](O)[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C16H30O4Si/c1-11(15(18)19-5)13-9-8-12(20-13)10-14(17)21(6,7)16(2,3)4/h12-14,17H,1,8-10H2,2-7H3/t12-,13+,14-/m1/s1 |
| InChIKey | ZCJONTTXAZBLQM-HZSPNIEDSA-N |
| XLogP | 3.06 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.50 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|