C19H34O7Si — CID 101457034
5-O-ethyl 1-O,1-O-dimethyl 4-triethylsilyloxyhex-5-ene-1,1,5-tricarboxylate (PubChem CID 101457034) has the molecular formula C19H34O7Si and a molecular weight of 402.56 g/mol. Its IUPAC name is 5-O-ethyl 1-O,1-O-dimethyl 4-triethylsilyloxyhex-5-ene-1,1,5-tricarboxylate.
| Compound Name | 5-O-ethyl 1-O,1-O-dimethyl 4-triethylsilyloxyhex-5-ene-1,1,5-tricarboxylate |
|---|---|
| PubChem CID | 101457034 |
| Molecular Formula | C19H34O7Si |
| Molecular Weight | 402.56 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | 5-O-ethyl 1-O,1-O-dimethyl 4-triethylsilyloxyhex-5-ene-1,1,5-tricarboxylate |
| SMILES | C=C(C(=O)OCC)C(CCC(C(=O)OC)C(=O)OC)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C19H34O7Si/c1-8-25-17(20)14(5)16(26-27(9-2,10-3)11-4)13-12-15(18(21)23-6)19(22)24-7/h15-16H,5,8-13H2,1-4,6-7H3 |
| InChIKey | NUVLCBWLYZMVCF-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.56 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|