C21H40O5Si — CID 19904720
diethyl 2-[6-[tert-butyl(dimethyl)silyl]oxy-2-methylideneheptyl]propanedioate (PubChem CID 19904720) has the molecular formula C21H40O5Si and a molecular weight of 400.63 g/mol. Its IUPAC name is diethyl 2-[6-[tert-butyl(dimethyl)silyl]oxy-2-methylideneheptyl]propanedioate.
| Compound Name | diethyl 2-[6-[tert-butyl(dimethyl)silyl]oxy-2-methylideneheptyl]propanedioate |
|---|---|
| PubChem CID | 19904720 |
| Molecular Formula | C21H40O5Si |
| Molecular Weight | 400.63 g/mol |
| Exact Mass | 400.26 |
| IUPAC Name | diethyl 2-[6-[tert-butyl(dimethyl)silyl]oxy-2-methylideneheptyl]propanedioate |
| SMILES | C=C(CCCC(C)O[Si](C)(C)C(C)(C)C)CC(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C21H40O5Si/c1-10-24-19(22)18(20(23)25-11-2)15-16(3)13-12-14-17(4)26-27(8,9)21(5,6)7/h17-18H,3,10-15H2,1-2,4-9H3 |
| InChIKey | YLDGUSKZDLQXKP-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.63 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|