C18H32O6Si — CID 10317194
triethyl (E)-6-trimethylsilylhex-5-ene-1,1,5-tricarboxylate (PubChem CID 10317194) has the molecular formula C18H32O6Si and a molecular weight of 372.53 g/mol. Its IUPAC name is triethyl (E)-6-trimethylsilylhex-5-ene-1,1,5-tricarboxylate.
| Compound Name | triethyl (E)-6-trimethylsilylhex-5-ene-1,1,5-tricarboxylate |
|---|---|
| PubChem CID | 10317194 |
| Molecular Formula | C18H32O6Si |
| Molecular Weight | 372.53 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | triethyl (E)-6-trimethylsilylhex-5-ene-1,1,5-tricarboxylate |
| SMILES | CCOC(=O)/C(=C/[Si](C)(C)C)CCCC(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C18H32O6Si/c1-7-22-16(19)14(13-25(4,5)6)11-10-12-15(17(20)23-8-2)18(21)24-9-3/h13,15H,7-12H2,1-6H3/b14-13+ |
| InChIKey | GXVJIQPROPEJKW-BUHFOSPRSA-N |
| XLogP | 3.27 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.53 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|