C22H42O5Si — CID 10938588
methyl (6S)-3-acetyloxy-6-methyl-2-methylidene-8-tri(propan-2-yl)silyloxyoctanoate (PubChem CID 10938588) has the molecular formula C22H42O5Si and a molecular weight of 414.66 g/mol. Its IUPAC name is methyl (6S)-3-acetyloxy-6-methyl-2-methylidene-8-tri(propan-2-yl)silyloxyoctanoate.
| Compound Name | methyl (6S)-3-acetyloxy-6-methyl-2-methylidene-8-tri(propan-2-yl)silyloxyoctanoate |
|---|---|
| PubChem CID | 10938588 |
| Molecular Formula | C22H42O5Si |
| Molecular Weight | 414.66 g/mol |
| Exact Mass | 414.28 |
| IUPAC Name | methyl (6S)-3-acetyloxy-6-methyl-2-methylidene-8-tri(propan-2-yl)silyloxyoctanoate |
| SMILES | C=C(C(=O)OC)C(CC[C@H](C)CCO[Si](C(C)C)(C(C)C)C(C)C)OC(C)=O |
| InChI | InChI=1S/C22H42O5Si/c1-15(2)28(16(3)4,17(5)6)26-14-13-18(7)11-12-21(27-20(9)23)19(8)22(24)25-10/h15-18,21H,8,11-14H2,1-7,9-10H3/t18-,21?/m0/s1 |
| InChIKey | PNXHCODIOVIFLR-YMXDCFFPSA-N |
| XLogP | 5.65 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.66 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|