C24H44O6Si — CID 11604938
tert-butyl (Z,4R,5S)-10-acetyloxy-5-[tert-butyl(dimethyl)silyl]oxy-4,8-dimethyl-3-oxodec-8-enoate (PubChem CID 11604938) has the molecular formula C24H44O6Si and a molecular weight of 456.70 g/mol. Its IUPAC name is tert-butyl (Z,4R,5S)-10-acetyloxy-5-[tert-butyl(dimethyl)silyl]oxy-4,8-dimethyl-3-oxodec-8-enoate.
| Compound Name | tert-butyl (Z,4R,5S)-10-acetyloxy-5-[tert-butyl(dimethyl)silyl]oxy-4,8-dimethyl-3-oxodec-8-enoate |
|---|---|
| PubChem CID | 11604938 |
| Molecular Formula | C24H44O6Si |
| Molecular Weight | 456.70 g/mol |
| Exact Mass | 456.29 |
| IUPAC Name | tert-butyl (Z,4R,5S)-10-acetyloxy-5-[tert-butyl(dimethyl)silyl]oxy-4,8-dimethyl-3-oxodec-8-enoate |
| SMILES | CC(=O)OC/C=C(/C)CC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C(=O)CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H44O6Si/c1-17(14-15-28-19(3)25)12-13-21(30-31(10,11)24(7,8)9)18(2)20(26)16-22(27)29-23(4,5)6/h14,18,21H,12-13,15-16H2,1-11H3/b17-14-/t18-,21-/m0/s1 |
| InChIKey | PBOTXPFSBLEXCV-BLNCWZOJSA-N |
| XLogP | 5.60 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.70 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|