C22H44O5Si2 — CID 53483809
methyl (4R,5R,6R)-4-hydroxy-2-methylidene-5,6-bis(triethylsilyloxy)oct-7-enoate (PubChem CID 53483809) has the molecular formula C22H44O5Si2 and a molecular weight of 444.76 g/mol. Its IUPAC name is methyl (4R,5R,6R)-4-hydroxy-2-methylidene-5,6-bis(triethylsilyloxy)oct-7-enoate.
| Compound Name | methyl (4R,5R,6R)-4-hydroxy-2-methylidene-5,6-bis(triethylsilyloxy)oct-7-enoate |
|---|---|
| PubChem CID | 53483809 |
| Molecular Formula | C22H44O5Si2 |
| Molecular Weight | 444.76 g/mol |
| Exact Mass | 444.27 |
| IUPAC Name | methyl (4R,5R,6R)-4-hydroxy-2-methylidene-5,6-bis(triethylsilyloxy)oct-7-enoate |
| SMILES | C=C[C@@H](O[Si](CC)(CC)CC)[C@H](O[Si](CC)(CC)CC)[C@H](O)CC(=C)C(=O)OC |
| InChI | InChI=1S/C22H44O5Si2/c1-10-20(26-28(11-2,12-3)13-4)21(27-29(14-5,15-6)16-7)19(23)17-18(8)22(24)25-9/h10,19-21,23H,1,8,11-17H2,2-7,9H3/t19-,20-,21-/m1/s1 |
| InChIKey | DLGNPWZKKBTQJQ-NJDAHSKKSA-N |
| XLogP | 5.43 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.76 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|