C20H40O6Si2 — CID 11419081
methyl (3R,4R,5S,6S)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-3,4-dihydroxycyclohexene-1-carboxylate (PubChem CID 11419081) has the molecular formula C20H40O6Si2 and a molecular weight of 432.71 g/mol. Its IUPAC name is methyl (3R,4R,5S,6S)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-3,4-dihydroxycyclohexene-1-carboxylate.
| Compound Name | methyl (3R,4R,5S,6S)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-3,4-dihydroxycyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 11419081 |
| Molecular Formula | C20H40O6Si2 |
| Molecular Weight | 432.71 g/mol |
| Exact Mass | 432.24 |
| IUPAC Name | methyl (3R,4R,5S,6S)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-3,4-dihydroxycyclohexene-1-carboxylate |
| SMILES | COC(=O)C1=C[C@@H](O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H40O6Si2/c1-19(2,3)27(8,9)25-16-13(18(23)24-7)12-14(21)15(22)17(16)26-28(10,11)20(4,5)6/h12,14-17,21-22H,1-11H3/t14-,15-,16+,17+/m1/s1 |
| InChIKey | DCSMYGGJITXPBD-NCOADZHNSA-N |
| XLogP | 3.60 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.71 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|