C17H32O5Si — CID 11078465
tert-butyl (3S,4S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-3,4-dihydroxycyclohexene-1-carboxylate (PubChem CID 11078465) has the molecular formula C17H32O5Si and a molecular weight of 344.52 g/mol. Its IUPAC name is tert-butyl (3S,4S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-3,4-dihydroxycyclohexene-1-carboxylate.
| Compound Name | tert-butyl (3S,4S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-3,4-dihydroxycyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 11078465 |
| Molecular Formula | C17H32O5Si |
| Molecular Weight | 344.52 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | tert-butyl (3S,4S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-3,4-dihydroxycyclohexene-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1=C[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C17H32O5Si/c1-16(2,3)21-15(20)11-9-12(18)14(19)13(10-11)22-23(7,8)17(4,5)6/h9,12-14,18-19H,10H2,1-8H3/t12-,13-,14-/m0/s1 |
| InChIKey | NPKPSFXHKZAUJA-IHRRRGAJSA-N |
| XLogP | 2.77 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.52 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|