C20H40O5Si2 — CID 10905821
methyl (3R,4S,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-hydroxycyclohexene-1-carboxylate (PubChem CID 10905821) has the molecular formula C20H40O5Si2 and a molecular weight of 416.71 g/mol. Its IUPAC name is methyl (3R,4S,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-hydroxycyclohexene-1-carboxylate.
| Compound Name | methyl (3R,4S,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-hydroxycyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 10905821 |
| Molecular Formula | C20H40O5Si2 |
| Molecular Weight | 416.71 g/mol |
| Exact Mass | 416.24 |
| IUPAC Name | methyl (3R,4S,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-hydroxycyclohexene-1-carboxylate |
| SMILES | COC(=O)C1=C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C20H40O5Si2/c1-19(2,3)26(8,9)24-15-12-14(18(22)23-7)13-16(17(15)21)25-27(10,11)20(4,5)6/h12,15-17,21H,13H2,1-11H3/t15-,16-,17-/m1/s1 |
| InChIKey | RZSDQOPHHDFYMO-BRWVUGGUSA-N |
| XLogP | 4.63 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.71 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|