C19H29IO3 — CID 101488694
(4R,5S)-4-[(R)-hexoxy(phenyl)methyl]-5-(iodomethyl)-2,2-dimethyl-1,3-dioxolane (PubChem CID 101488694) has the molecular formula C19H29IO3 and a molecular weight of 432.34 g/mol. Its IUPAC name is (4R,5S)-4-[(R)-hexoxy(phenyl)methyl]-5-(iodomethyl)-2,2-dimethyl-1,3-dioxolane.
| Compound Name | (4R,5S)-4-[(R)-hexoxy(phenyl)methyl]-5-(iodomethyl)-2,2-dimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 101488694 |
| Molecular Formula | C19H29IO3 |
| Molecular Weight | 432.34 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | (4R,5S)-4-[(R)-hexoxy(phenyl)methyl]-5-(iodomethyl)-2,2-dimethyl-1,3-dioxolane |
| SMILES | CCCCCCO[C@H](c1ccccc1)[C@H]1OC(C)(C)O[C@@H]1CI |
| InChI | InChI=1S/C19H29IO3/c1-4-5-6-10-13-21-17(15-11-8-7-9-12-15)18-16(14-20)22-19(2,3)23-18/h7-9,11-12,16-18H,4-6,10,13-14H2,1-3H3/t16-,17-,18+/m1/s1 |
| InChIKey | WHQDHIMPIKZQOL-KURKYZTESA-N |
| XLogP | 5.28 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.34 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|