C11H17O2S2+ — CID 101491020
(3R,7R)-5,5-dimethyl-4,6-dioxa-10-thia-1-thioniatricyclo[7.4.0.03,7]tridec-8-ene (PubChem CID 101491020) has the molecular formula C11H17O2S2+ and a molecular weight of 245.39 g/mol. Its IUPAC name is (3R,7R)-5,5-dimethyl-4,6-dioxa-10-thia-1-thioniatricyclo[7.4.0.03,7]tridec-8-ene.
| Compound Name | (3R,7R)-5,5-dimethyl-4,6-dioxa-10-thia-1-thioniatricyclo[7.4.0.03,7]tridec-8-ene |
|---|---|
| PubChem CID | 101491020 |
| Molecular Formula | C11H17O2S2+ |
| Molecular Weight | 245.39 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | (3R,7R)-5,5-dimethyl-4,6-dioxa-10-thia-1-thioniatricyclo[7.4.0.03,7]tridec-8-ene |
| SMILES | CC1(C)O[C@H]2C[S+]3CCCSC3=C[C@H]2O1 |
| InChI | InChI=1S/C11H17O2S2/c1-11(2)12-8-6-10-14-4-3-5-15(10)7-9(8)13-11/h6,8-9H,3-5,7H2,1-2H3/q+1/t8-,9+,15?/m1/s1 |
| InChIKey | FLAGDGMINJUYDJ-QTOXJJMPSA-N |
| XLogP | 2.12 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.39 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|