C18H28O5 — CID 101492836
(4S,6S)-6-(methoxymethoxy)-8-[4-(methoxymethoxy)phenyl]oct-1-en-4-ol (PubChem CID 101492836) has the molecular formula C18H28O5 and a molecular weight of 324.42 g/mol. Its IUPAC name is (4S,6S)-6-(methoxymethoxy)-8-[4-(methoxymethoxy)phenyl]oct-1-en-4-ol.
| Compound Name | (4S,6S)-6-(methoxymethoxy)-8-[4-(methoxymethoxy)phenyl]oct-1-en-4-ol |
|---|---|
| PubChem CID | 101492836 |
| Molecular Formula | C18H28O5 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.19 |
| IUPAC Name | (4S,6S)-6-(methoxymethoxy)-8-[4-(methoxymethoxy)phenyl]oct-1-en-4-ol |
| SMILES | C=CC[C@H](O)C[C@H](CCc1ccc(OCOC)cc1)OCOC |
| InChI | InChI=1S/C18H28O5/c1-4-5-16(19)12-18(23-14-21-3)11-8-15-6-9-17(10-7-15)22-13-20-2/h4,6-7,9-10,16,18-19H,1,5,8,11-14H2,2-3H3/t16-,18-/m0/s1 |
| InChIKey | CMEUPSCOBUMHNA-WMZOPIPTSA-N |
| XLogP | 2.92 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|