About cyclopenta-2,4-dien-1-yl-[1-methyl-4-(4-nitrophenyl)pyrrolidin-3-yl]methanone
cyclopenta-2,4-dien-1-yl-[1-methyl-4-(4-nitrophenyl)pyrrolidin-3-yl]methanone (PubChem CID 101493406) has the molecular formula C17H18N2O3
and a molecular weight of 298.34 g/mol. Its IUPAC name is cyclopenta-2,4-dien-1-yl-[1-methyl-4-(4-nitrophenyl)pyrrolidin-3-yl]methanone.
Molecular Properties
| Compound Name | cyclopenta-2,4-dien-1-yl-[1-methyl-4-(4-nitrophenyl)pyrrolidin-3-yl]methanone |
| PubChem CID | 101493406 |
| Molecular Formula | C17H18N2O3 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | cyclopenta-2,4-dien-1-yl-[1-methyl-4-(4-nitrophenyl)pyrrolidin-3-yl]methanone |
| SMILES | CN1CC(C(=O)C2C=CC=C2)C(c2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C17H18N2O3/c1-18-10-15(12-6-8-14(9-7-12)19(21)22)16(11-18)17(20)13-4-2-3-5-13/h2-9,13,15-16H,10-11H2,1H3 |
| InChIKey | IMMVWYYKDWOURD-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze cyclopenta-2,4-dien-1-yl-[1-methyl-4-(4-nitrophenyl)pyrrolidin-3-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopenta-2,4-dien-1-yl-[1-methyl-4-(4-nitrophenyl)pyrrolidin-3-yl]methanone?
The IUPAC name of cyclopenta-2,4-dien-1-yl-[1-methyl-4-(4-nitrophenyl)pyrrolidin-3-yl]methanone (CID 101493406) is cyclopenta-2,4-dien-1-yl-[1-methyl-4-(4-nitrophenyl)pyrrolidin-3-yl]methanone.
What is the SMILES notation for cyclopenta-2,4-dien-1-yl-[1-methyl-4-(4-nitrophenyl)pyrrolidin-3-yl]methanone?
The canonical SMILES for cyclopenta-2,4-dien-1-yl-[1-methyl-4-(4-nitrophenyl)pyrrolidin-3-yl]methanone is CN1CC(C(=O)C2C=CC=C2)C(c2ccc([N+](=O)[O-])cc2)C1.
What is the InChIKey of cyclopenta-2,4-dien-1-yl-[1-methyl-4-(4-nitrophenyl)pyrrolidin-3-yl]methanone?
The InChIKey is IMMVWYYKDWOURD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18N2O3/c1-18-10-15(12-6-8-14(9-7-12)19(21)22)16(11-18)17(20)13-4-2-3-5-13/h2-9,13,15-16H,10-11H2,1H3.
What are the key properties of cyclopenta-2,4-dien-1-yl-[1-methyl-4-(4-nitrophenyl)pyrrolidin-3-yl]methanone?
cyclopenta-2,4-dien-1-yl-[1-methyl-4-(4-nitrophenyl)pyrrolidin-3-yl]methanone has a molecular weight of 298.34 g/mol, XLogP of 2.55, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopenta-2,4-dien-1-yl-[1-methyl-4-(4-nitrophenyl)pyrrolidin-3-yl]methanone is sourced from PubChem (CID 101493406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).