C12H15N3O3 — CID 156824660
1,4-dimethyl-5-(4-nitrophenyl)piperazin-2-one (PubChem CID 156824660) has the molecular formula C12H15N3O3 and a molecular weight of 249.27 g/mol. Its IUPAC name is 1,4-dimethyl-5-(4-nitrophenyl)piperazin-2-one.
| Compound Name | 1,4-dimethyl-5-(4-nitrophenyl)piperazin-2-one |
|---|---|
| PubChem CID | 156824660 |
| Molecular Formula | C12H15N3O3 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | 1,4-dimethyl-5-(4-nitrophenyl)piperazin-2-one |
| SMILES | CN1CC(c2ccc([N+](=O)[O-])cc2)N(C)CC1=O |
| InChI | InChI=1S/C12H15N3O3/c1-13-8-12(16)14(2)7-11(13)9-3-5-10(6-4-9)15(17)18/h3-6,11H,7-8H2,1-2H3 |
| InChIKey | VEHSAPOGCDMHHU-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 66.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|