C23H35NO3 — CID 101493949
methyl 2-[(3aS,3bR,5aS,9aS,9bR)-3b,6,6,9a-tetramethyl-3-oxo-1,3a,4,5,5a,7,8,9,9b,10-decahydronaphtho[2,1-e]isoindol-2-yl]acetate (PubChem CID 101493949) has the molecular formula C23H35NO3 and a molecular weight of 373.54 g/mol. Its IUPAC name is methyl 2-[(3aS,3bR,5aS,9aS,9bR)-3b,6,6,9a-tetramethyl-3-oxo-1,3a,4,5,5a,7,8,9,9b,10-decahydronaphtho[2,1-e]isoindol-2-yl]acetate.
| Compound Name | methyl 2-[(3aS,3bR,5aS,9aS,9bR)-3b,6,6,9a-tetramethyl-3-oxo-1,3a,4,5,5a,7,8,9,9b,10-decahydronaphtho[2,1-e]isoindol-2-yl]acetate |
|---|---|
| PubChem CID | 101493949 |
| Molecular Formula | C23H35NO3 |
| Molecular Weight | 373.54 g/mol |
| Exact Mass | 373.26 |
| IUPAC Name | methyl 2-[(3aS,3bR,5aS,9aS,9bR)-3b,6,6,9a-tetramethyl-3-oxo-1,3a,4,5,5a,7,8,9,9b,10-decahydronaphtho[2,1-e]isoindol-2-yl]acetate |
| SMILES | COC(=O)CN1CC2=CC[C@H]3[C@@](C)(CC[C@H]4C(C)(C)CCC[C@]34C)[C@@H]2C1=O |
| InChI | InChI=1S/C23H35NO3/c1-21(2)10-6-11-22(3)16(21)9-12-23(4)17(22)8-7-15-13-24(14-18(25)27-5)20(26)19(15)23/h7,16-17,19H,6,8-14H2,1-5H3/t16-,17+,19-,22-,23+/m0/s1 |
| InChIKey | RAFZYCOHMYGSSK-IGGQLTPSSA-N |
| XLogP | 4.20 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.54 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|