C28H28N4O4 — CID 101493998
2-[(4aS)-5,11-dioxo-2,4,4a,6-tetrahydro-1H-pyrazino[2,1-c][1,4]benzodiazepin-3-yl]-N-[(4-methoxyphenyl)methyl]-2-phenylacetamide (PubChem CID 101493998) has the molecular formula C28H28N4O4 and a molecular weight of 484.56 g/mol. Its IUPAC name is 2-[(4aS)-5,11-dioxo-2,4,4a,6-tetrahydro-1H-pyrazino[2,1-c][1,4]benzodiazepin-3-yl]-N-[(4-methoxyphenyl)methyl]-2-phenylacetamide.
| Compound Name | 2-[(4aS)-5,11-dioxo-2,4,4a,6-tetrahydro-1H-pyrazino[2,1-c][1,4]benzodiazepin-3-yl]-N-[(4-methoxyphenyl)methyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 101493998 |
| Molecular Formula | C28H28N4O4 |
| Molecular Weight | 484.56 g/mol |
| Exact Mass | 484.21 |
| IUPAC Name | 2-[(4aS)-5,11-dioxo-2,4,4a,6-tetrahydro-1H-pyrazino[2,1-c][1,4]benzodiazepin-3-yl]-N-[(4-methoxyphenyl)methyl]-2-phenylacetamide |
| SMILES | COc1ccc(CNC(=O)C(c2ccccc2)N2CCN3C(=O)c4ccccc4NC(=O)[C@@H]3C2)cc1 |
| InChI | InChI=1S/C28H28N4O4/c1-36-21-13-11-19(12-14-21)17-29-27(34)25(20-7-3-2-4-8-20)31-15-16-32-24(18-31)26(33)30-23-10-6-5-9-22(23)28(32)35/h2-14,24-25H,15-18H2,1H3,(H,29,34)(H,30,33)/t24-,25?/m0/s1 |
| InChIKey | BHDCCTARJRXRPS-SKCDSABHSA-N |
| XLogP | 2.83 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.56 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |