C28H32N4O2 — CID 101496030
17-(pyridin-2-ylmethyl)-2,5-dioxa-13,17,21-triazatricyclo[21.4.0.06,11]heptacosa-1(27),6,8,10,12,21,23,25-octaene (PubChem CID 101496030) has the molecular formula C28H32N4O2 and a molecular weight of 456.59 g/mol. Its IUPAC name is 17-(pyridin-2-ylmethyl)-2,5-dioxa-13,17,21-triazatricyclo[21.4.0.06,11]heptacosa-1(27),6,8,10,12,21,23,25-octaene.
| Compound Name | 17-(pyridin-2-ylmethyl)-2,5-dioxa-13,17,21-triazatricyclo[21.4.0.06,11]heptacosa-1(27),6,8,10,12,21,23,25-octaene |
|---|---|
| PubChem CID | 101496030 |
| Molecular Formula | C28H32N4O2 |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.25 |
| IUPAC Name | 17-(pyridin-2-ylmethyl)-2,5-dioxa-13,17,21-triazatricyclo[21.4.0.06,11]heptacosa-1(27),6,8,10,12,21,23,25-octaene |
| SMILES | C1=N\CCCN(Cc2ccccn2)CCC/N=C/c2ccccc2OCCOc2ccccc2/1 |
| InChI | InChI=1S/C28H32N4O2/c1-3-12-27-24(9-1)21-29-14-7-17-32(23-26-11-5-6-16-31-26)18-8-15-30-22-25-10-2-4-13-28(25)34-20-19-33-27/h1-6,9-13,16,21-22H,7-8,14-15,17-20,23H2/b29-21-,30-22+ |
| InChIKey | FJPIRHJCAYHHNJ-DWVPNOFWSA-N |
| XLogP | 4.67 |
| TPSA | 59.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |