C40H48N8 — CID 102160550
7,23-bis(pyridin-2-ylmethyl)-3,7,11,19,23,27-hexazatricyclo[27.3.1.113,17]tetratriaconta-1(33),2,11,13(34),14,16,18,27,29,31-decaene (PubChem CID 102160550) has the molecular formula C40H48N8 and a molecular weight of 640.88 g/mol. Its IUPAC name is 7,23-bis(pyridin-2-ylmethyl)-3,7,11,19,23,27-hexazatricyclo[27.3.1.113,17]tetratriaconta-1(33),2,11,13(34),14,16,18,27,29,31-decaene.
| Compound Name | 7,23-bis(pyridin-2-ylmethyl)-3,7,11,19,23,27-hexazatricyclo[27.3.1.113,17]tetratriaconta-1(33),2,11,13(34),14,16,18,27,29,31-decaene |
|---|---|
| PubChem CID | 102160550 |
| Molecular Formula | C40H48N8 |
| Molecular Weight | 640.88 g/mol |
| Exact Mass | 640.40 |
| IUPAC Name | 7,23-bis(pyridin-2-ylmethyl)-3,7,11,19,23,27-hexazatricyclo[27.3.1.113,17]tetratriaconta-1(33),2,11,13(34),14,16,18,27,29,31-decaene |
| SMILES | C1=N\CCCN(Cc2ccccn2)CCC/N=C/c2cccc(c2)/C=N/CCCN(Cc2ccccn2)CCC/N=C\c2cccc/1c2 |
| InChI | InChI=1S/C40H48N8/c1-3-21-45-39(15-1)33-47-23-7-17-41-29-35-11-5-13-37(27-35)31-43-19-9-25-48(34-40-16-2-4-22-46-40)26-10-20-44-32-38-14-6-12-36(28-38)30-42-18-8-24-47/h1-6,11-16,21-22,27-32H,7-10,17-20,23-26,33-34H2/b41-29-,42-30+,43-31-,44-32+ |
| InChIKey | ZIJZZVIDSVEBOC-DPJWGYPZSA-N |
| XLogP | 6.43 |
| TPSA | 81.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.88 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |