C24H32O3 — CID 101499304
ethyl 6-(2-cyclohexylethyl)-2-methyl-5-methylidene-4-phenyl-4H-pyran-3-carboxylate (PubChem CID 101499304) has the molecular formula C24H32O3 and a molecular weight of 368.52 g/mol. Its IUPAC name is ethyl 6-(2-cyclohexylethyl)-2-methyl-5-methylidene-4-phenyl-4H-pyran-3-carboxylate.
| Compound Name | ethyl 6-(2-cyclohexylethyl)-2-methyl-5-methylidene-4-phenyl-4H-pyran-3-carboxylate |
|---|---|
| PubChem CID | 101499304 |
| Molecular Formula | C24H32O3 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.24 |
| IUPAC Name | ethyl 6-(2-cyclohexylethyl)-2-methyl-5-methylidene-4-phenyl-4H-pyran-3-carboxylate |
| SMILES | C=C1C(CCC2CCCCC2)OC(C)=C(C(=O)OCC)C1c1ccccc1 |
| InChI | InChI=1S/C24H32O3/c1-4-26-24(25)23-18(3)27-21(16-15-19-11-7-5-8-12-19)17(2)22(23)20-13-9-6-10-14-20/h6,9-10,13-14,19,21-22H,2,4-5,7-8,11-12,15-16H2,1,3H3 |
| InChIKey | DSCYQDFDBBMVPH-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|