C25H20Cl3N3O2 — CID 10152346
N-[2-[[5-(4-chlorophenyl)-3-cyano-6-(2,4-dichlorophenyl)-2-pyridinyl]oxy]ethyl]cyclobutanecarboxamide (PubChem CID 10152346) has the molecular formula C25H20Cl3N3O2 and a molecular weight of 500.81 g/mol. Its IUPAC name is N-[2-[[5-(4-chlorophenyl)-3-cyano-6-(2,4-dichlorophenyl)-2-pyridinyl]oxy]ethyl]cyclobutanecarboxamide.
| Compound Name | N-[2-[[5-(4-chlorophenyl)-3-cyano-6-(2,4-dichlorophenyl)-2-pyridinyl]oxy]ethyl]cyclobutanecarboxamide |
|---|---|
| PubChem CID | 10152346 |
| Molecular Formula | C25H20Cl3N3O2 |
| Molecular Weight | 500.81 g/mol |
| Exact Mass | 499.06 |
| IUPAC Name | N-[2-[[5-(4-chlorophenyl)-3-cyano-6-(2,4-dichlorophenyl)-2-pyridinyl]oxy]ethyl]cyclobutanecarboxamide |
| SMILES | N#Cc1cc(-c2ccc(Cl)cc2)c(-c2ccc(Cl)cc2Cl)nc1OCCNC(=O)C1CCC1 |
| InChI | InChI=1S/C25H20Cl3N3O2/c26-18-6-4-15(5-7-18)21-12-17(14-29)25(33-11-10-30-24(32)16-2-1-3-16)31-23(21)20-9-8-19(27)13-22(20)28/h4-9,12-13,16H,1-3,10-11H2,(H,30,32) |
| InChIKey | AYYXHEXYNSQCSS-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.81 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|